Deuterated THF

Deuterated THF
Identifiers
CAS number	1693-74-9
PubChem	80290
ChemSpider	72531 Y
EC number	216-898-4
UN number	2056
Beilstein Reference	111854
Jmol-3D images	Image 1
SMILES [2H]C1([2H])OC([2H])([2H])C([2H])([2H])C1([2H])[2H]
InChI InChI=1S/C4H8O/c1-2-4-5-3-1/h1-4H2/i1D2,2D2,3D2,4D2 Y Key: WYURNTSHIVDZCO-SVYQBANQSA-N Y
Properties
Molecular formula	C42H8O
Molar mass	80.1550 g mol-1
Exact mass	80.107728846 g mol-1
Density	985 mg cm-3
Melting point	-106 °C, 167 K, -159 °F
Boiling point	65-66 °C, 338-339 K, 149-151 °F
Hazards
GHS pictograms
GHS signal word	DANGER
GHS hazard statements	H225, H319, H335
GHS precautionary statements	P210, P261, P305+351+338
EU classification	F Xi
R-phrases	R11, R19, R36/37
S-phrases	S16, S29, S33
NFPA 704	3 2 0
Flash point	-17 °C
Y THF (verify) (what is: Y/N?) Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa)
Infobox references

Deuterated tetrahydrofuran (d₈-THF), is a colourless, organic liquid at standard temperature and pressure. This heterocyclic compound has the chemical formula (C²H₂)₄O, and is the isotopologue of tetrahydrofuran. Deuterated THF is a rarely used as a solvent in NMR spectroscopy due to its expense.^{[citation needed]}