Blonanserin

Drugbox
IUPAC_name = 2-(4-ethylpiperazin-1-yl)-4-(4-fluorophenyl)-5,6,7,8,9,10-hexahydrocycloocta [b] pyridine

---

CAS_number = 132810-10-7
CAS_supplemental =
ATC_prefix =
ATC_suffix =
ATC_supplemental =
PubChem = 125564
DrugBank =
chemical_formula =
C=23 | H=30 | F=1 | N=3
molecular_weight = 367.50 g/mol
smiles = CCN1CCN(CC1)C2=NC3=C(CCCCCC3)C(=C2)C4=CC=C(C=C4)F
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status = Rx-only
routes_of_administration = Oral

Blonanserin (INN, also known as AD-5423 and marketed under the brand name Lonasen) is a 5-HT₂ receptor antagonist and Dopamine receptor D₂ antagonist [Oka M, Noda Y, Ochi Y, Furukawa K, Une T, Kurumiya S, Hino K, Karasawa T. Pharmacological profile of AD-5423, a novel antipsychotic with both potent dopamine-D2 and serotonin-S2 antagonist properties. "Journal of Pharmacology and Experimental Therapeutics". 1993 Jan;264(1):158-65. PMID 8093723] used as an antipsychotic. [Ochi T, Sakamoto M, Minamida A, Suzuki K, Ueda T, Une T, Toda H, Matsumoto K, Terauchi Y. Syntheses and properties of the major hydroxy metabolites in humans of blonanserin AD-5423, a novel antipsychotic agent. "Bioorganic and Medicinal Chemistry Letters". 2005 Feb 15;15(4):1055-9. PMID 15686911]

References