- Fasudil
Drugbox
IUPAC_name = 5-(1,4-diazepan-1-ylsulfonyl)isoquinoline
CAS_number = 103745-39-7
CAS_supplemental =
ATC_prefix = C04
ATC_suffix = AX32
ATC_supplemental =
PubChem = 3547
DrugBank =
chemical_formula =
C=14 | H=17 | N=3 | O=2 | S=1 | Se= | Sr= | Tc= | Zn= | charge=
molecular_weight = 291.36 g/mol
smiles = C1CNCCN(C1)S(=O)(=O)C2=CC=CC3=C2C=CN=C3
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =Fasudil (INN) is a potent Rho-kinase inhibitor for the treatment of cerebral vasospasm.cite journal |author=Shibuya M, Suzuki Y |title= [Treatment of cerebral vasospasm by a protein kinase inhibitor AT 877] |language=Japanese |journal=No To Shinkei |volume=45 |issue=9 |pages=819–24 |year=1993 |month=September |pmid=8217408 |doi= |url=]
References
Wikimedia Foundation. 2010.