- Carindacillin
Drugbox
IUPAC_name = (2"S",5"R",6"R")-6-( [3-(2,3-dihydro-1"H"-inden-5-yloxy)-3-oxo-2-phenylpropanoyl] amino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo [3.2.0] heptane-2-carboxylic acid
CAS_number = 26605-69-6
CAS_supplemental =
ATC_prefix = J01
ATC_suffix = CA05
ATC_supplemental =
PubChem = 93184
DrugBank =
chemical_formula =
C=26 | H=26 | N=2 | O=6 | S=1
molecular_weight = 494.55 g/mol
smiles = CC1(C(N2C(S1)C(C2=O)NC(=O)C(C3=CC=CC=C3)C(=O)OC4=CC5=C(CCC5)C=C4)C(=O)O)C
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status = Rx-only
routes_of_administration = OralCarindacillin (INN), also known as Carbenicillin indanyl (USAN) is a
penicillin antibiotic . It is aprodrug ofcarbenicillin .cite journal |author=English AR, Retsema JA, Ray VA, Lynch JE |title=Carbenicillin indanyl sodium, an orally active derivative of carbenicillin |journal=Antimicrob. Agents Chemother. |volume=1 |issue=3 |pages=185–91 |year=1972 |month=March |pmid=4558137 |pmc=444190 |doi= |url=http://aac.asm.org/cgi/pmidlookup?view=long&pmid=4558137]It is administered orally, as the sodium salt. It is marketed by
Pfizer under the brand name Geocillin.References
Wikimedia Foundation. 2010.