Phenampromide

drugbox
IUPAC_name = N-phenyl-N-(1-piperidin-1-ylpropan-2-yl)propanamide

---

width = 180
CAS_number = 129-83-9
synonyms = Phenampromide
ATC_prefix =
ATC_suffix =
PubChem = 8523
smiles = Cl.CCC(=O)N(C(C)CN1CCCCC1)c1ccccc1
DrugBank =
C = 17 | H = 26 | N = 2 | O = 1
molecular_weight = 274.40 g/mol
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =

Phenampromide is an opioid analgesic from the ampromide family of drugs, related to other drugs such as propiram and diampromide. It was invented in the 1960s. [Portoghese PS. Stereochemical Studies on Medicinal Agents II. Absolute Configuration of (-)-Phenampromide. "Journal of Medicinal Chemistry". 1965 Mar;8:147-50.]

Phenampromide produces similar effects to other opioids, including analgesia, sedation, dizziness and nausea.

References