Tipepidine

drugbox
IUPAC_name = 3-(dithiophen-2-ylmethylidene)-1-methyl-piperidine

---

CAS_number = 5169-78-8
ATC_prefix = R05
ATC_suffix = DB24
PubChem = 5484
smiles = CN1CCCC(=C(c2cccs2)c2cccs2)C1
DrugBank =
C = 15 | H = 17 | N = 1 | S = 2
molecular_weight = 275.434 g/mol
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =

Tipepidine (Bithiodine, Sotal, Antupex, Asverin) is a centrally-acting cough suppressant of the opioid type. It is a member of the thiambutene series of open-chain (methadone-related) synthetic opioids, which include Ohton (dimethylthiambutene), a strong narcotic analgesic used particularly in veterinary medicine in Japan and other East Asian countries. It was developed in Japan in 1959 and is used as the citrate and hibenzate salts. The usual dose is 20 mg every 4–6 hours. Its relative weakness and other properties make it a drug which is not controlled in most countries or internationally.