- 3-Methylthiofentanyl
drugbox
IUPAC_name = N- [3-methyl-1-(2-thiophen-2-ylethyl)-4-piperidyl] -N-phenyl-propanamide
width = 100
CAS_number = 86052-04-2
synonyms = 3-methyl-thiofentanyl
ATC_prefix =
ATC_suffix =
PubChem = 62296
smiles = CCC(=O)N(c1ccccc1)C3CCN(CCc2cccs2)CC3C
DrugBank =
C = 21 | H = 28 | N = 2 | O = 1 | S = 1
molecular_weight = 356.526 g/mol
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA = Schedule I
legal_UK = Class A
legal_US = Schedule I
legal_status =
routes_of_administration =3-Methyl-thiofentanyl is an
opioid analgesic that is an analogue offentanyl .3-Methyl-thiofentanyl was sold briefly on the black market in the early 1980s, before the introduction of the
Federal Analog Act which for the first time attempted to control entire families of drugs based on their structural similarity rather than scheduling each drug individually as they appeared. [ Henderson GL. Designer Drugs: Past History and Future Prospects. Journal of Forensic Sciences 1988; 33(2):569-575 ]3-Methyl-thiofentanyl has similar effects to fentanyl. Side effects of fentanyl analogues are similar to those of fentanyl itself, which include
itching ,nausea and potentially seriousrespiratory depression which can be life-threatening.References
Wikimedia Foundation. 2010.