- Auraptene
Chembox new
ImageFile = Auraptene.png
ImageSize = 250px
IUPACName = 7-(("E")-3, 7-Dimethylocta-2, 6-dienyloxy)-2"H"-chromen-2-one
OtherNames = Aurapten
7-Geranyloxycoumarin
Section1 = Chembox Identifiers
CASNo = 495-02-3
PubChem = 1550607
SMILES = CC(=CCC/C(=C/COC1=CC2=C(C=C1)C=CC(=O)O2)/C)C
Section2 = Chembox Properties
C=19|H=22|O=3
MolarMass = 298.376 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =Auraptene is a natural bioactive
monoterpene coumarin ether . It was first isolated from members of the genus "Citrus ". Auraptene has shown a remarkable effect in the prevention ofdegenerative disease s. Many studies have reported the effect of auraptene as a chemopreventative agent against cancers of liver, skin, tongue, esophagus, and colon in rodent models. [Curini, M., Carvotto, G., Epifano, F. and Giannone, G. "Chemistry and Biological Activity of Natural and Synthetic Prenyloxycoumarins"(2006). "Current Medicinal Chemistry", 13, 199-222.] The effect in humans is not yet known.References
Wikimedia Foundation. 2010.