Indometacin farnesil

Drugbox
IUPAC_name = (6"E")-3,7,11-trimethyl-2,6,10-dodecatrienyl 1-("p"-chlorobenzoyl)-5-methoxy-2-methyl-1"H"-indole-3-acetate

---

CAS_number = 85801-02-1
ATC_prefix =
ATC_suffix =
PubChem = 5282183
DrugBank =
C=34|H=40|Cl=1|N=1|O=4
molecular_weight = 562.14 g/mol
smiles = CC1=C(C2=C(N1C(=O)C3=CC=C(C=C3)Cl)C=CC(=C2)OC)CC(=O)OCC=C(C)CCC=C(C)CCC=C(C)C
bioavailability =
protein_bound =
metabolism = To indometacin
elimination_half-life = 1.5 hours
excretion = Renal
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_status = Rx-only
routes_of_administration = Oral

Indometacin farnesil (INN) is a prodrug of the non-steroidal anti-inflammatory drug indometacin, designed to reduce the occurrence of side-effects by esterification of the carboxyl group on indometacin with farnesol. Indometacin farnesil was first approved in Japan in 1991, and is available in Japan and Indonesia, under the trade names Infree and Dialon respectively.

External links

* [http://www2.eisai.co.jp/di2/EPI/INF_C-SC_EPI.pdf Infree prescribing information] from Eisai Co.