- Sinapinic acid
Chembox new
Name = Sinapinic acid
ImageFile = sinapic acid.png
IUPACName = 3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoic acid
OtherNames = Sinapinic acid
Sinapic acid
3,5-Dimethoxy-4-hydroxycinnamic acid
4-Hydroxy-3,5-dimethoxycinnamic acid
Section1 = Chembox Identifiers
CASNo = 530-59-6
SMILES = COC1=CC(=CC(=C1O)OC)C=CC(=O)O
Section2 = Chembox Properties
Formula = C11H12O5
MolarMass = 224.21 g/mol
MeltingPt = 203-205 °C (decomposes)Sinapinic acid, or sinapic acid, is a small naturally occurring
carboxylic acid . It is a member of thephenylpropanoid family. It is a commonly used matrix in MALDImass spectrometry .cite journal |author=Beavis RC, Chait BT |title=Matrix-assisted laser-desorption mass spectrometry using 355 nm radiation |journal=Rapid Commun. Mass Spectrom. |volume=3 |issue=12 |pages=436–9 |year=1989 |pmid=2520224 |doi=10.1002/rcm.1290031208] cite journal |author=Beavis RC, Chait BT |title=Cinnamic acid derivatives as matrices for ultraviolet laser desorption mass spectrometry of proteins |journal=Rapid Commun. Mass Spectrom. |volume=3 |issue=12 |pages=432–5 |year=1989 |pmid=2520223 |doi=10.1002/rcm.1290031207] It is a useful matrix for a wide variety of peptides and proteins. It serves well as a matrix for MALDI due to its ability to absorblaser radiation and to also donate protons (H+)to the analyte of interest.ources
* [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?sid=3765|The PubChem database]
ee also
Matrix-assisted laser desorption/ionization References
Wikimedia Foundation. 2010.
