Fadrozole

Drugbox
IUPAC_name = 4-(5,6,7,8-tetrahydroimidazo [5,1-f] pyridin-5-yl)benzonitrile


CAS_number = 102676-31-3
CAS_supplemental =
ATC_prefix =
ATC_suffix =
ATC_supplemental =
PubChem = 59693
DrugBank =
chemical_formula =
C=14 | H=13 | N=3
molecular_weight = 223.27 g/mol
smiles = C1CC(N2C=NC=C2C1)C3=CC=C(C=C3)C#N
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status = Rx-only
routes_of_administration = Oral

Fadrozole (INN, marketed as Afema by Novartis) is an aromatase inhibitor that has been introduced in Japan for the treatment of breast cancer.

References

*cite journal |author=Browne LJ, Gude C, Rodriguez H, Steele RE, Bhatnager A |title=Fadrozole hydrochloride: a potent, selective, nonsteroidal inhibitor of aromatase for the treatment of estrogen-dependent disease |journal=J. Med. Chem. |volume=34 |issue=2 |pages=725–36 |year=1991 |month=February |pmid=1825337 |doi= |url=
*cite journal |author=Raats JI, Falkson G, Falkson HC |title=A study of fadrozole, a new aromatase inhibitor, in postmenopausal women with advanced metastatic breast cancer |journal=J. Clin. Oncol. |volume=10 |issue=1 |pages=111–6 |year=1992 |month=January |pmid=1530798 |doi= |url=http://www.jco.org/cgi/pmidlookup?view=long&pmid=1530798

ee also

*Aromatase inhibitor