U-89843A

drugbox
IUPAC_name = 6,7-dimethyl-2,4-dipyrrolidin-1-ylpyrrolo [3,2-e] pyrimidine


width = 200
CAS_number = 157013-32-6
ATC_prefix =
ATC_suffix =
PubChem = 154689
DrugBank =
C = 16 | H = 23 | N = 5
molecular_weight = 285.387 g/mol
smiles = CC1=CC2=C(N1C)N=C(N=C2N3CCCC3)N4CCCC4
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status = Legal
routes_of_administration =

U-89843A (PNU-89843) is a sedative drug which acts as an agonist at GABA_A receptors, specifically acting as a positive allosteric modulator selective for the α1, α3 and α6 subtypes. [Im HK, Im WB, Pregenzer JF, Carter DB, Hamilton BJ. U-89843A is a novel allosteric modulator of gamma-aminobutyric acidA receptors. "Journal of Pharmacology and Experimental Therapeutics". 1995 Dec;275(3):1390-5. PMID 8531107] It has sedative effects in animals but without causing ataxia, and also acts as an antioxidant and may have neuroprotective effects. [Bundy GL, Ayer DE, Banitt LS, Belonga KL, Mizsak SA, Palmer JR, Tustin JM, Chin JE, Hall ED, Linseman KL, et al. Synthesis of novel 2,4-diaminopyrrolo- [2,3-d] pyrimidines with antioxidant, neuroprotective, and antiasthma activity. "Journal of Medicinal Chemistry". 1995 Oct 13;38(21):4161-3. PMID 7473542]

References