- Melibiose
-
Melibiose (2R,3R,4S,5S,6R)-6-[[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrolIdentifiers CAS number 5340-95-4 PubChem 11458 MeSH Melibiose ChEMBL CHEMBL1159652 Jmol-3D images Image 1 - C([C@@H]1[C@@H]([C@@H]([C@H]([C@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)O)O)O)O)O)O)O)O
Properties Molecular formula C12H22O11 Molar mass 342.30 g/mol (verify) (what is: / ?)
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa)Infobox references Melibiose is a disaccharide formed by an alpha linkage between galactose and glucose (D-Gal-α(1→6)-D-Glc). It can be formed by invertase mediated hydrolysis of raffinose, which produces melibiose and fructose. Melibiose can be broken down into its component saccharides, glucose and galactose, by the enzyme encoded by the gene GLA. Contains a hemiacetal carbon, which makes it a reducing sugar.
This article about an organic compound is a stub. You can help Wikipedia by expanding it.