- Spirobarbital
drugbox
IUPAC_name = 1-ethyl-2,4-dimethyl-7,9-diazaspiro [4.5] decane-6,8,10-trione
width = 200
CAS_number = 12262-77-0
synonyms = Spirobarbital, 5-spiro-(2'-ethyl-3'-5'-dimethyl-cyclopentyl)barbituric acid
ATC_prefix =
ATC_suffix =
PubChem =
DrugBank =
C=12 | H=18 | N=2 | O=3
molecular_weight = 238.282 g/mol
smiles = O=C2NC(=O)NC(=O)C12C(CC)C(C)CC1C
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =Spirobarbital is a
barbiturate derivative invented in the 1970s. It hashypnotic andsedative effects, and has a moderate potential for abuse. [Isbell H, Chrusciel TS. Dependence Liability of Non-Narcotic Drugs. "Bulletin of the World Health Organisation" 1970; 43: Supplement.]References
Wikimedia Foundation. 2010.