- Tetraphenylene
Chembox new
Reference = [ [http://www.sigmaaldrich.com/catalog/search/ProductDetail/ALDRICH/379328?cm_mmc=PubChem-_-public%20database-_-products-_-products Tetraphenylene] atSigma-Aldrich ]
Name = Tetraphenylene
ImageFile = Tetraphenylene.svg
ImageSize = 154px
IUPACName = Tetrabenzocyclooctatetraene
Section1 = Chembox Identifiers
CASNo = 212-74-8
PubChem = 2724868
SMILES = C1=CC=C2C(=C1)C3=CC=CC=C3 C4=CC=CC=C4C5=CC=CC=C25
Section2 = Chembox Properties
Formula = C24H16
MolarMass = 304.39 g/mol
MeltingPt = 232-235 °C
BoilingPt =
Density =Tetraphenylene is an
organic compound , solid at room temperature, with thechemical formula C24H16. It is a member of the unsaturated polycyclichydrocarbon s class of compounds.ee also
*
Cyclooctatetraene References
Wikimedia Foundation. 2010.