- VCHSR
Drugbox
IUPAC_name = 5-(4- chlorophenyl)-3- [(E)-2-cyclohexylethenyl] -1-(2,4-dichlorophenyl)-4-methyl-1H-pyrazole
CAS_number =
ATC_prefix =
ATC_suffix =
PubChem =
DrugBank =
chemical_formula = |C=24|H=23|Cl=3|N=2
molecular_weight = 445.811
smiles = C4CCCCC4C=Cc(c(C)c1-c(cc3)ccc3Cl)nn1-c2ccc(Cl)cc2Cl
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =VCHSR is a drug used in scientific research which acts as a selective antagonist of the
cannabinoid receptor CB1. It is derived from the widely used CB1 antagonistrimonabant , and has similar potency and selectivity for the CB1 receptor, but has been modified to remove the hydrogen bonding capability in the C3 substituent region, which removes theinverse agonist effect that rimonabant produces at high doses, so that VCHSR instead acts as a neutral antagonist, blocking the receptor but producing no physiological effect of its own. [Hurst DP, Lynch DL, Barnett-Norris J, Hyatt SM, Seltzman HH, Zhong M, Song Z-H, NieJ, Lewis D, Reggio PH (2002) N-(Piperidin-1-yl)-5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methyl-1H-pyrazole-3-carboxamide (SR141716A) interaction with LYS 3.28(192) is crucial for its inverse agonism at the cannabinoid CB1 receptor. "Molecular Pharmacology". 2002 Dec;62(6):1274-87. PMID 12435794] [Hurst D, Umejiego U, Lynch D, Seltzman H, Hyatt S, Roche M, McAllister S, Fleischer D, Kapur A, Abood M, Shi S, Jones J, Lewis D, Reggio P. Biarylpyrazole inverse agonists at the cannabinoid CB1 receptor: importance of the C-3 carboxamide oxygen/lysine3.28(192) interaction. "Journal of Medicinal Chemistry". 2006 Oct 5;49(20):5969-87. PMID 17004712]References
Wikimedia Foundation. 2010.