- Rivoglitazone
Drugbox
IUPAC_name = 5-{4- [(6-methoxy-1-methyl-1"H"-benzimidazol-2-yl) methoxy] benzyl}-1,3-thiazolidine-2,4-dione
CAS_number = 185428-18-6
ATC_prefix =
ATC_suffix =
PubChem = 3055168
DrugBank =
C=20|H=19|N=3|O=4|S=1
molecular_weight = 397.448 g/mol
smiles = CN1C2=C(C=CC(=C2)OC)N=C1COC3=CC=C(C=C3)CC4C(=O)NC(=O)S4
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =Rivoglitazone (INN) is a
thiazolidinedione undergoing research for use in the treatment oftype 2 diabetes .cite journal |author=Schimke K, Davis TM |title=Drug evaluation: rivoglitazone, a new oral therapy for the treatment of type 2 diabetes |journal=Curr Opin Investig Drugs |volume=8 |issue=4 |pages=338–44 |year=2007 |pmid=17458185 |doi=]It is being developed by
Daiichi Sankyo Co. References
Wikimedia Foundation. 2010.