Etoxeridine

drugbox
IUPAC_name = ethyl 1- [2-(2-hydroxyethoxy)ethyl] -4-phenylpiperidine-4-carboxylate

---

width = 160
CAS_number = 469-82-9
synonyms = Etoxeridine, Carbetidine, Atenos
ATC_prefix =
ATC_suffix =
PubChem = 61122
smiles = C1(CCN(CC1)CCOCCO)(C(=O)OCC)C2=CC=CC=C2
DrugBank =
C = 18 | H = 27 | N = 1 | O = 4
molecular_weight = 321.41 g/mol
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK = Class A
legal_US = Schedule I
legal_status =
routes_of_administration =

Etoxeridine (Carbetidine, Atenos) is a 4-phenylpiperidine derivative that is related to the opioid analgesic drug pethidine (meperidine).

Etoxeridine was developed in the 1950s and investigated for use in surgical anasthesia, however it was never commercialised and is not currently used in medicine. [Merlevede E, Levis S. Pharmacological study of carbetidine, a new synthetic analgesic. (French). "Archives Internationales de Pharmacodynamie et de Therapie". 1958 May 1;115(1-2):213-32.] [Sironi PG. Brief note on a new synthetic analgesic: carbetidine hydrochloride. (Italian). "Minerva Anestesiologica". 1959 Jun;25(6):251-4.] [Crawford JS, Foldes FF. Studies on the respiratory and circulatory effects of carbetidine HCI used for supplementation of thiopentone sodium-nitrous oxide-oxygen anaesthesia. "British Journal of Anaesthesia". 1959 Aug;31:348-51.]

References