Benzethidine

drugbox
IUPAC_name = ethyl 4-phenyl-1-(2-phenylmethoxyethyl)piperidine-4-carboxylate

---

width = 160
CAS_number = 3691-78-9
synonyms = Benzethidine
ATC_prefix =
ATC_suffix =
PubChem = 62516
smiles = C1(=CC=CC=C1)COCCN2CCC(CC2)(C(OCC)=O)C3=CC=CC=C3
DrugBank =
C = 23 | H = 29 | N = 1 | O = 3
molecular_weight = 367.48 g/mol
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK = Class A
legal_US = Schedule I
legal_status =
routes_of_administration =

Benzethidine is a 4-phenylpiperidine derivative that is related to the opioid analgesic drug pethidine (meperidine). [Maul C, Buschmann H, Sundermann B. Opioids: 3.3 Synthetic Opioids. "Analgesics" 2005; 159-169. ISBN 9783527304035]

Benzethidine is not currently used in medicine and is a Class A/Schedule I drug which is controlled under UN drug conventions. It has similar effects to other opioid derivatives, such as analgesia, sedation, nausea and respiratory depression. [Cahal DA, Dare JG, Keith D. A Sequential Trial of Analgesics in Labour. "International Journal of Obstetrics and Gynaecology" 1961; 68(1): 88–93.]

References

[http://www.unodc.org/unodc/en/bulletin/bulletin_1961-01-01_4_page004.html UNODC Bulletin on Narcotics 1961]