MDDM

Chembox new
ImageFile1 = MDDM.png ImageSize1 = 200px
ImageFile2 =
ImageSize2 = 200px
IUPACName = (2-Benzo [1,3] dioxol-5-yl-1-methyl-ethyl)-dimethyl-amine
OtherNames = 3,4-Methylenedioxy-N,N-dimethylamphetamine
3,4-Methylenedioxy-(alpha,N,N-trimethyl)-1-ethane
Section1 = Chembox Identifiers
CASNo = 74698-50-3
PubChem =
SMILES = C1=C2C(=CC=C1CC(C)N(C)C)OCO2
Section2 = Chembox Properties
Formula = C₁₂H₁₇NO₂
MolarMass = 207.27 g/mol
Appearance =
Density =
MeltingPt = 172-173 °C
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =

MDDM, or 3,4-methylenedioxy-N,N-dimethylamphetamine, is a lesser-known psychedelic drug. It is also the N,N-dimethyl isomer of MDA. MDDM was first synthesized by Alexander Shulgin. In his book "PiHKAL (Phenethylamines i Have Known And Loved)", the dosage is unspecified, and the duration unknown. MDDM produces only mild effects that are not well characterised in PiHKAL. Very little data exists about the pharmacological properties, metabolism, and toxicity of MDDM. This compound is however occasionally encountered as an impurity in MDMA which has been synthesized by methylation of MDA using methylating reagents such as methyl iodide, as an excess of reagent or too high a reaction temperature results in some double methylation of the amine nitrogen, yielding MDDM as well as MDMA. Presence of MDDM as an impurity can thus reveal which synthetic route was used to manufacture seized samples of MDMA.

See also

* Phenethylamine
* Psychedelics, dissociatives and deliriants
* MDA

External links

* [http://www.erowid.org/library/books_online/pihkal/pihkal105.shtml MDDM entry in "PiHKAL"]