EEM (psychedelic)

Chembox new
ImageFile1 = EEM.png ImageSize1 = 200px
ImageFile2 = EEM-3d-sticks.png ImageSize2 = 180px
IUPACName = 2-(2,4-Diethoxy-5-methoxy-phenyl)-1-methyl-ethylamine
OtherNames =
Section1 = Chembox Identifiers
CASNo =
PubChem =
SMILES = CCOc1cc(OCC)c(cc1OC)CC(C)N
Section2 = Chembox Properties
Formula = C₁₄H₂₃NO₃
MolarMass = 253.34 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =

EEM, or 2,4-diethoxy-5-methoxyamphetamine, is a lesser-known psychedelic drug. It is a diethoxy-methoxy analog of TMA-2. EEM was first synthesized by Alexander Shulgin. In his book "PiHKAL (Phenethylamines i Have Known And Loved)", both the dosage and duration are unknown. EEM produces few to no effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of EEM.

See also

* Phenethylamine
* Psychedelics, dissociatives and deliriants

External links

* [http://www.erowid.org/library/books_online/pihkal/pihkal074.shtml EEM Entry in "PiHKAL"]