Iodocyanopindolol

Drugbox
IUPAC_name = 4- [2-hydroxy-3-(propan-2-ylamino)propoxy] -3-iodo-1H-indole-2-carbonitrile


CAS_number = 83498-72-0
CAS_supplemental =
ATC_prefix =
ATC_suffix =
ATC_supplemental =
PubChem = 68618
DrugBank =
chemical_formula =
C=15 | H=18 | I=1 | N=3 | O=2
molecular_weight = 399.227 g/mol
smiles = CC(C)NCC(COC1=CC=CC2=C1C(=C(N2)C#N)I)O
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =

Iodocyanopindolol (INN) is a drug related to pindolol which acts as both a β₁ adrenoreceptor antagonist and a 5-HT1A receptor antagonist. Its ¹²⁵I radiolabelled derivative has been widely used in mapping the distribution of beta adrenoreceptors in the body. [Brodde OE, Karad K, Zerkowski HR, Rohm N, Reidemeister JC. Coexistence of beta 1- and beta 2-adrenoceptors in human right atrium. Direct identification by (+/-)- [125I] iodocyanopindolol binding. "Circulation Research". 1983 Dec;53(6):752-8. PMID 6139182]

References