- Camostat
Drugbox
IUPAC_name = "N","N"-dimethylcarbamoylmethyl 4-(4-guanidinobenzoyloxy)phenylacetate
CAS_number = 59721-29-8
CAS_supplemental = (mesylate )
ATC_prefix = B02
ATC_suffix = AB04
ATC_supplemental =
PubChem = 2536
DrugBank =
C=20 | H=22 | N=4 | O=5
molecular_weight = 398.41 g/mol
smiles = CN(C)C(=O)COC(=O)CC1=CC=C(C=C1)OC(=O)C2=CC=C(C=C2)N=C(N)N
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status = Rx-only
routes_of_administration = OralCamostat (INN) is a
serine protease inhibitor.References
*cite journal |author=Kunze H, Bohn E |title=Effects of the serine protease inhibitors FOY and FOY 305 on phospholipase A1 (EC 3.1.1.32) activity in rat - liver lysosomes |journal=Pharmacol Res Commun |volume=15 |issue=5 |pages=451–9 |year=1983 |month=May |pmid=6412250 |doi= |url=
*cite journal |author=Göke B, Stöckmann F, Müller R, Lankisch PG, Creutzfeldt W |title=Effect of a specific serine protease inhibitor on the rat pancreas: systemic administration of camostate and exocrine pancreatic secretion |journal=Digestion |volume=30 |issue=3 |pages=171–8 |year=1984 |pmid=6209186 |doi= |url=
Wikimedia Foundation. 2010.