Xylamidine

drugbox
IUPAC_name = N'- [2-(3-methoxyphenoxy)propyl] -2-(3-methylphenyl)ethanimidamide

---

width = 220
CAS_number = 6443-50-1
synonyms = Xylamidine
ATC_prefix =
ATC_suffix =
PubChem = 22951
DrugBank =
C = 19 | H = 24 | N = 2 | O = 2
molecular_weight = 312.406 g/mol
smiles = CC1=CC(=CC=C1)CC(=NCC(C)OC2=CC=CC(=C2)OC)N
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =

Xylamidine is a drug which acts as an antagonist at the 5HT_2A receptor, and to a lesser extent at the 5HT_1A receptor. It does not cross the blood brain barrier which makes it useful for blocking peripheral serotonergic responses like cardiovascular [Fuller RW, Kurz KD, Mason NR, Cohen ML. Antagonism of a peripheral vascular but not an apparently central serotonergic response by xylamidine and BW 501C67. "European Journal of Pharmacology". 1986 Jun 5;125(1):71-7. PMID 3732393] [Dedeoğlu A, Fisher LA. Central and peripheral injections of the 5-HT2 agonist, 1-(2,5-dimethoxy-4-iodophenyl)-2-aminopropane, modify cardiovascular function through different mechanisms. "Journal of Pharmacology and Experimental Therapeutics". 1991 Dec;259(3):1027-34. PMID 1762059] and gastrointestinal effects, [Baker BJ, Duggan JP, Barber DJ, Booth DA. Effects of dl-fenfluramine and xylamidine on gastric emptying of maintenance diet in freely feeding rats. "European Journal of Pharmacology". 1988 May 20;150(1-2):137-42. PMID 3402534] without producing the central effects of 5HT_2A blockade such as sedation, or interfering with the central actions of 5HT_2A agonists. [Dave KD, Quinn JL, Harvey JA, Aloyo VJ. Role of central 5-HT2 receptors in mediating head bobs and body shakes in the rabbit. "Pharmacology, Biochemistry and Behaviour". 2004 Mar;77(3):623-9. PMID 15006475]

References