A-412,997

Drugbox
IUPAC_name = N-(3-methylphenyl)-2-(4-pyridin-2-ylpiperidin-1-yl)acetamide


CAS_number=
ATC_prefix=
ATC_suffix=
ATC_supplemental=
PubChem= 10425450
DrugBank=
C = 19 | H = 23 | N = 3 | O = 1
molecular_weight = 309.405 g/mol
smiles = c3ccc(cc3C)NC(=O)CN2CCC(CC2)c1ccccn1
bioavailability=
protein_bound =
metabolism =
elimination_half-life=
excretion =
licence_EU =
pregnancy_category =
legal_UK =
routes_of_administration=

A-412,997 is a drug which acts as a dopamine agonist that is used in scientific research. It is the first drug developed that is a highly selective agonist for the D₄ subtype, with significantly improved selectivity over older D₄-preferring compounds such as PD-168,077 and CP-226,269. [Moreland RB, Patel M, Hsieh GC, Wetter JM, Marsh K, Brioni JD. A-412997 is a selective dopamine D4 receptor agonist in rats. "Pharmacology, Biochemistry and Behaviour". 2005 Sep;82(1):140-7. PMID 16153699] It is unclear what applications this drug might be used for, but in animal tests it induced penile erection and improved cognitive performance in rats. [Browman KE, Curzon P, Pan JB, Molesky AL, Komater VA, Decker MW, Brioni JD, Moreland RB, Fox GB. A-412997, a selective dopamine D4 agonist, improves cognitive performance in rats. "Pharmacology, Biochemistry and Behaviour". 2005 Sep;82(1):148-55. PMID 16154186] Also unlike other dopamine agonists, selective D₄ agonists do not cause side effects such as sedation and nausea, and so might have advantages over older dopamine agonist drugs. [Osinski MA, Uchic ME, Seifert T, Shaughnessy TK, Miller LN, Nakane M, Cox BF, Brioni JD, Moreland RB. Dopamine D2, but not D4, receptor agonists are emetogenic in ferrets. "Pharmacology, Biochemistry and Behaviour". 2005 May;81(1):211-9. PMID 15894081]

References