- JWH-307
Drugbox
IUPAC_name = (5-(2-fluorophenyl)-1-pentylpyrrol-3-yl)-naphthalen-1-ylmethanone
CAS_number =
ATC_prefix =
ATC_suffix =
PubChem = 16049783
DrugBank =
C=26|H=24|F=1|N=1|O=1
molecular_weight = 385.472 g/mol
smiles = CCCCCN1C=C(C=C1C2=CC=CC=C2F)C(=O)C3=CC=CC4=CC=CC=C43
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status = Legal
routes_of_administration =JWH-307 is an
analgesic drug used in scientific research, which acts as acannabinoid agonist at both the CB1 and CB2 receptors. It is somewhat selective for the CB2 subtype, with a Ki of 7.7nM at CB1 vs 3.3nM at CB2. [Huffman JW, Padgett LW, Isherwood ML, Wiley JL, Martin BR. 1-Alkyl-2-aryl-4-(1-naphthoyl)pyrroles: New high affinity ligands for the cannabinoid CB1 and CB2 receptors. "Bioorganic & Medicinal Chemistry Letters" 2006; 16:5432-5435.]References
Wikimedia Foundation. 2010.