- Amrubicin
Drugbox
IUPAC_name = (7"S",9"S")-9-Acetyl-9-amino-7- [(2"S",4"S",5"R")-4,5-dihydroxyoxan-2-yl] oxy-6,11-dihydroxy-8,10-dihydro-7"H"-tetracene-5,12-dione
CAS_number = 110267-81-7
CAS_supplemental =
ATC_prefix =
ATC_suffix =
ATC_supplemental =
PubChem = 178149
DrugBank =
chemical_formula =
C=25 | H=25 | N=1 | O=9
molecular_weight = 483.46 g/mol
smiles = CC(=O)C1(CC(C2=C(C3=C(C(=C2C1)O)C(=O)C4=CC=CC=C4C3=O)O)OC5CC(C(CO5)O)O)N
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status = Rx-only
routes_of_administration = IVAmrubicin (INN; previously known as SM-5887) is an
anthracycline used in the treatment oflung cancer .cite journal |author=Ueoka H, Ohnoshi T, Kimura I |title= [New anthracycline analogues in the treatment of lung cancer] |language=Japanese |journal=Gan To Kagaku Ryoho |volume=19 |issue=13 |pages=2146–9 |year=1992 |month=November |pmid=1332624 |doi= |url=] It is marketed in Japan since 2002 by Sumitomo Pharmaceuticals under the brand name Calsed.cite web | author = Sumitomo Pharmaceuticals Co., Ltd. | year = 2003 | url = http://www.e-search.ne.jp/~jpr/PDF/SUMITO17.PDF | title = CALSED for Injection (English) | accessdate = 2008-08-17]It has also been studied for the treatment of bladder carcinomacite journal |author=Ohmori H, Tsushima T, Kobashi K |title= [Experimental studies on intravesical instillation of SM-5887, a novel anthracycline derivative for treatment of bladder carcinoma] |language=Japanese |journal=Gan To Kagaku Ryoho |volume=23 |issue=5 |pages=601–6 |year=1996 |month=April |pmid=8678519 |doi= |url=] and gastric cancer.cite journal |author=Tsushima K, Sakata Y, Munakata A, "et al" |title= [A phase II study of SM-5887 for advanced gastric cancer] |language=Japanese |journal=Gan To Kagaku Ryoho |volume=18 |issue=7 |pages=1151–4 |year=1991 |month=June |pmid=1647150 |doi= |url=]
References
Wikimedia Foundation. 2010.
