- Hexyl cinnamaldehyde
Chembox new
ImageFile = Hexyl cinnamaldehyde.png
IUPACName = ("2E")-2-benzylideneoctanal
OtherNames =
Section1 = Chembox Identifiers
CASNo = 101-86-0
PubChem = 1550884
SMILES = CCCCCC/C(=CC1=CC=CC=C1)/C=O
Section2 = Chembox Properties
C=15|H=20|O=1
MolarMass = 216.319 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility = Insoluble
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =Hexyl cinnamaldehyde, or hexyl cinnamal, is a common additive in perfume and cosmetic industry as aroma substance. It is found naturally in the
essential oil ofchamomile .Properties
It is a pale yellow to yellow clear liquid to solid, which is insoluble in water but soluble in oils.
Toxicity
Hexyl cinnamaldehyde is a class B allergen according to
DIMDI classification. It is also an irritant in concentrations higher than recommended.References
* [http://www.borlind.com/IngredientDictionary2.html Dictionary of Ingredients H-M]
* [http://membres.lycos.fr/leflacon/ingredient.php?fiche=211 Le Flacon - ingrédient Hexyl Cinnamal]
* [http://www.thegoodscentscompany.com/data/rw1005971.html alpha-hexyl cinnamaldehyde] (data sheet, 3-D Java applet showing the molecule.)
Wikimedia Foundation. 2010.
