MDCPM

Chembox new
ImageFile = MDCPM.png ImageSize =
IUPACName = "N"-(cyclopropylmethyl)-1-(3a,7a-dihydro- 1,3-benzodioxol-5-yl)propan-2-amine
OtherNames =
Section1 = Chembox Identifiers
CASNo =
PubChem =
SMILES = C3OC1C(C=CC(=C1)CC(C)NCC2CC2)O3
Section2 = Chembox Properties
Formula = C₁₄H₂₁NO₂
MolarMass = 235.325 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =

MDCPM, or 3,4-methylenedioxy-"N"-cyclopropylmethylamphetamine, is a lesser-known psychedelic drug. It is also the "N"-cyclopropylmethyl isomer of MDA. MDCPM was first synthesized by Alexander Shulgin. In his book "PiHKAL (Phenethylamines i Have Known And Loved)", the minimum dosage is listed as 10mg, and the duration unknown. MDCPM produces few to no effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of MDCPM.

See also

* Phenethylamine
* Psychedelics, dissociatives and deliriants
* MDA

External links

* [http://www.erowid.org/library/books_online/pihkal/pihkal104.shtml MDCPM entry in "PiHKAL"]