- 5-Bromo-DMT
Chembox new
Name = 5-Bromo-DMT
ImageFile = 5-Bromo-DMT.svg
ImageName =
IUPACName = 5-bromo-N,N-dimethyltryptamine
Section1 = Chembox Identifiers
CASNo =
PubChem = 360252
SMILES = CN(C)CCC1=CNC2=C1C=C(Br)C=C2
Section2 = Chembox Properties
Formula = C12H15N2Br
MolarMass =
Density =
MeltingPt = 98-99 °C
BoilingPt =5-Bromo-DMT (5-bromo-N,N-dimethyltryptamine) is a brominated
indole alkaloid found in certain marineinvertebrate s. It is the 5-bromo analogue of DMT, ahallucinogen found in many plants and animals. Other naturally occurring 5-substituted analogues of DMT includebufotenin and5-MeO-DMT , both of which, like DMT, arepsychoactive and found in plants and animals.References
* Djura, Peter et al. (1980). Some Metabolites of the Marine Sponges "Smenospongia aurea" and "Smenospongia" (= "Polyfibrospongia") "echina". "Journal of Organic Chemistry" 45(8), 1435-1441
Wikimedia Foundation. 2010.