MDIP

Chembox new
ImageFile1 = MDIP.png ImageSize1 = 200px
ImageFile2 =
ImageSize2 = 200px
IUPACName = (2-Benzo [1,3] dioxol-5-yl-1-methyl-ethyl)-isopropyl-amine
OtherNames = 3,4-Methylenedioxy-"N"-isopropylamphetamineamine
3,4-Methylenedioxy-1-(alpha-methyl-amino-isopropyl)-ethane
Section1 = Chembox Identifiers
CASNo =
PubChem =
SMILES = C1=C2C(=CC=C1CC(C)NC(C)C)OCO2
Section2 = Chembox Properties
Formula = C₁₃H₁₉NO₂
MolarMass =221.299 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =

MDIP, or 3,4-methylenedioxy-N-Isopropylamphetamine, is a lesser-known psychedelic drug and a substituted amphetamine. It is also the N-isopropyl analogue of MDA. MDIP was first synthesized by Alexander Shulgin. In his book "PiHKAL (Phenethylamines i Have Known And Loved)", the minimum dosage is listed as 250 mg. MDIP produces a mild threshold. Very little data exists about the pharmacological properties, metabolism, and toxicity of MDIP.

See also

* Phenethylamine
* Psychedelics, dissociatives and deliriants

External links

* [http://www.erowid.org/library/books_online/pihkal/pihkal108.shtml MDIP entry in "PiHKAL"]