MDHOET

Chembox new
ImageFile1 = MDHOET.png ImageSize1 = 200px
ImageFile2 =
ImageSize2 = 200px
IUPACName = 2-(2-Benzo [1,3] dioxol-5-yl-1-methyl-ethylamino)-ethanol
OtherNames = 3,4-Methylenedioxy-N-hydroxyethylamphetamine
3,4-Methylenedioxy-1-(alpha-methyl-amino-hydroxyethyl)-ethane
Section1 = Chembox Identifiers
CASNo =
PubChem =
SMILES = C1=C2C(=CC=C1CC(C)NCCO)OCO2
Section2 = Chembox Properties
Formula = C₁₂H₁₇NO₃
MolarMass = 223.271 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =

MDHOET, or 3,4-methylenedioxy-N-hydroxyethylamphetamine, is a lesser-known psychedelic drug and a substituted amphetamine. It is also the N-hydroxyethyl analogue of MDA. MDHOET was first synthesized by Alexander Shulgin. In his book "PiHKAL (Phenethylamines i Have Known And Loved)", the minimum dosage is listed as 50 mg. MDHOET produces few to no effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of MDHOET.

See also

* Phenethylamine
* Psychedelics, dissociatives and deliriants

External links

* [http://www.erowid.org/library/books_online/pihkal/pihkal107.shtml MDHOET entry in "PiHKAL"]