MEE (psychedelic)

Chembox new
ImageFile = MEE.png ImageSize = 200px
IUPACName = 2-(4,5-Diethoxy-2-methoxy-phenyl)-1-methyl-ethylamine
OtherNames = 2-Methoxy-4,5-diethoxyphenethylamine
Section1 = Chembox Identifiers
CASNo = 23693-35-8
PubChem =
SMILES = NC(C)CC1=C(OC)C=C(OCC)C(OCC)=C1
Section2 = Chembox Properties
Formula = C₁₄H₂₃NO₃
MolarMass = 253.34
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =

MEE, or 2-methoxy-4,5-diethoxyamphetamine, is a lesser-known psychedelic drug. It is a diethoxy-methoxy analog of TMA-2. MEE was first synthesized by Alexander Shulgin. In his book "PiHKAL (Phenethylamines i Have Known And Loved)", both the dosage and duration are unknown. MEE produces few to no effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of MEE.

See also

* Phenethylamine
* Psychedelics, dissociatives and deliriants

External links

* [http://www.erowid.org/library/books_online/pihkal/pihkal121.shtml MEE entry in "PiHKAL"]