EMM (psychedelic)

Chembox new
ImageFile1 = EMM.png ImageSize1 = 200px
IUPACName = 2-(2-Ethoxy-4,5-dimethoxy-phenyl)-1-methyl-ethylamine
OtherNames =
Section1 = Chembox Identifiers
CASNo =
PubChem =
SMILES = C1(=CC(=C(C=C1CC(C)N)OC)OC)OCC
Section2 = Chembox Properties
Formula = C₁₃H₂₁NO₃
MolarMass = 239.314 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =

EMM, or 2-ethoxy-4,5-dimethoxyamphetamine, is a lesser-known psychedelic drug. It is a dimethoxy-ethoxy analog of TMA-2. EMM was first synthesized by Alexander Shulgin. In his book "PiHKAL (Phenethylamines i Have Known And Loved)", both the dosage and duration are unknown. EMM produces few to no effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of EMM.

See also

* Phenethylamine
* Psychedelics, dissociatives and deliriants

External links

* [http://www.erowid.org/library/books_online/pihkal/pihkal076.shtml EMM Entry in "PiHKAL"]