EME (psychedelic)

Chembox new
ImageFile = EME.png ImageSize = 200px
IUPACName = 2-(2,5-Diethoxy-4-methoxy-phenyl)-1-methyl-ethylamine

OtherNames =
Section1 = Chembox Identifiers
CASNo =
PubChem =
SMILES = C1(=CC(=C(C=C1CC(C)N)OCC)OC)OCC
Section2 = Chembox Properties
Formula = C₁₄H₂₃NO₃
MolarMass = 253.341 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =

EME, or 2,5-diethoxy-4-methoxyamphetamine, is a lesser-known psychedelic drug. It is a diethoxy-methoxy analog of TMA-2. EME was first synthesized by Alexander Shulgin. In his book "PiHKAL (Phenethylamines i Have Known And Loved)", both the dosage and duration are unknown. EME produces few to no effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of EME.

See also

* Phenethylamine
* Psychedelics, dissociatives and deliriants

External links

* [http://www.erowid.org/library/books_online/pihkal/pihkal075.shtml EME Entry in "PiHKAL"]