EEE (psychedelic)

Chembox new
ImageFile1 = EEE.png ImageSize1 = 200px
ImageFile2 = EEE-3d-sticks.png ImageSize2 = 180px
IUPACName = 1-Methyl-2-(2,4,5-triethoxyphenyl)ethylamine
OtherNames =
Section1 = Chembox Identifiers
CASNo =
PubChem =
SMILES = CCOc1cc(OCC)c(cc1OCC)CC(C)N
Section2 = Chembox Properties
Formula = C₁₅H₂₅NO₃
MolarMass = 267.36 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =

EEE, or 2,4,5-triethoxyamphetamine, is a lesser-known psychedelic drug. It is the triethoxy analog of TMA-2. EEE was first synthesized by Alexander Shulgin. In his book "PiHKAL (Phenethylamines i Have Known And Loved)", both the dosage and duration are unknown. EEE produces few to no effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of EEE.

See also

* Phenethylamine
* Psychedelics, dissociatives and deliriants

External links

* [http://www.erowid.org/library/books_online/pihkal/pihkal073.shtml EEE Entry in "PiHKAL"]