BOB (psychedelic)

Chembox new
ImageFile1 = 4-bromo-2,5,beta-trimethoxy-phenethylamine.png ImageSize1 =
ImageFile2 = BOB-3d-sticks.png ImageSize2 =
IUPACName = 2-(4-Bromo-2,5-dimethoxy-phenyl)-2-methoxy-ethylamine
OtherNames = 4-Bromo-2,5,beta-trimethoxyphenethylamine
2-(4-Bromo-2,5,beta-trimethoxyphenyl)ethanamine
Section1 = Chembox Identifiers
CASNo =
PubChem =
SMILES = COc1cc(c(cc1Br)OC)C(CN)OC
Section2 = Chembox Properties
Formula = C₁₁H₁₆NO₃Br
MolarMass = 290.153 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =

BOB, or 4-bromo-2,5,beta-trimethoxyphenethylamine, is a lesser-known psychedelic drug. It is the beta-hydroxy analog of 2C-B. BOB was first synthesized by Alexander Shulgin. In his book "PiHKAL (Phenethylamines i Have Known And Loved)", the dosage range is listed as 10-20 mg, and the duration listed as 10-20 hours. BOB produces an altered state of consciousness, tinnitus, a pleasant tingling throughout the body, and a sense of awareness. [CitePiHKAL] Very little data exists about the pharmacological properties, metabolism, and toxicity of BOB.

References

See also

* Phenethylamine
* Psychedelics, dissociatives and deliriants

External links

* [http://www.erowid.org/library/books_online/pihkal/pihkal013.shtml BOB Entry in "PiHKAL"]