Phenescaline

Chembox new
ImageFile = Phenescaline.png ImageSize =
IUPACName = 2- [3,5-dimethoxy-4-(2-phenylethoxy)phenyl] ethanamine
OtherNames =
Section1 = Chembox Identifiers
CASNo =
PubChem =
SMILES = COc2cc(cc(OC)c2OCCc1ccccc1)CCN
Section2 = Chembox Properties
Formula = C₁₈H₂₃NO₃
MolarMass = 301.380 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =

Phenescaline, or 3,5-dimethoxy-4-phenethoxyphenethylamine, is a lesser-known psychedelic drug. It is an analog of mescaline. Phenescaline was first synthesized by Alexander Shulgin. In his book "PiHKAL (Phenethylamines i Have Known And Loved)", the minimum dosage is listed as 150mg, and the duration is unknown. [CitePiHKAL] Phenescaline produces a threshold effect. Very little data exists about the pharmacological properties, metabolism, and toxicity of phenescaline.

References

See also

* Phenethylamine
* Psychedelics, dissociatives and deliriants

External links

* [http://www.erowid.org/library/books_online/pihkal/pihkal141.shtml Phenescaline entry in "PiHKAL"]