- HOT-2
Chembox new
ImageFile1 = HOT-2.png
ImageSize1 = 200px
ImageFile2 =
ImageSize2 = 200px
IUPACName = "N"- [2-(4-Ethylsulfanyl-2,5-dimethoxy-phenyl)-ethyl] -hydroxylamine
OtherNames = 2- [4-(Ethylthio)-2,5-dimethoxyphenyl] ethanaminol
Section1 = Chembox Identifiers
CASNo = 207740-38-3
PubChem =
SMILES = C1(=CC(=C(C=C1CCNO)OC)SCC)OC
Section2 = Chembox Properties
Formula = C12H19NO3S
MolarMass = 257.347 g/mol
Appearance =
Density =
MeltingPt = 122 °C
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =HOT-2, or 2,5-di
methoxy -4-(β-ethyl thio )-N-hydroxy phenethylamine is apsychedelic phenethylamine of the 2C family. It was presumably first synthesized byAlexander Shulgin and reported in his book "PiHKAL (Phenethylamines i Have Known And Loved)".Chemistry
HOT-2's full chemical name is 2- [4-(2-
ethyl thio )-2,5-dimethoxy phenyl -N-hydroxy ethanamine. It has structural properties similar to2C-T-2 and to other drugs in the HOT- series, with the most closely related compounds beingHOT-7 andHOT-17 .General Information
The dosage range of HOT-2 is typically 10-18 mg and its duration is approximately 6-10
hours according to Shulgin. HOT-2 produces visuals and moving, flowing lights. It also causes euphoria and increases blood pressure.ee also
*
Phenethylamine External links
* [http://www.erowid.org/library/books_online/pihkal/pihkal087.shtml PiHKAL #87 HOT-2]
Wikimedia Foundation. 2010.