5-MeO-2,N,N-TMT

drugbox
IUPAC_name = 2-(5-methoxy-2-methyl-H-indol-3-yl)-N,N-dimethylethanamine

---

width = 140
CAS_number = 67292-68-6
ATC_prefix =
ATC_suffix =
PubChem = 49756
C=14 | H=20 | N=2 | O=1
molecular_weight = 232.321 g/mol
smiles = CC1=C(C2=C(N1)C=CC(=C2)OC)CCN(C)C
melting_point =
melting_high =
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category =
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =

5-MeO-2,"N","N"-trimethyltryptamine (5-MeO-2,N,N-TMT) is a tryptamine derivative that is a hallucinogenic drug. It was invented by Alexander Shulgin and reported in his book TiHKAL (#45) [ [http://www.erowid.org/library/books_online/tihkal/tihkal45.shtml Erowid Online Books : "TIHKAL" - #45 5-MEO-TMT ] ] . It is claimed to show psychoactive effects at a dosage of 75-150mg orally, but these are relatively mild compared to other similar drugs, suggesting that while the 2-methyl group has blocked the binding of metabolic enzymes, it is also interfering with binding to the 5HT_2A receptor target that mediates the hallucinogenic effects of these drugs.

References