MTSL

Chembox new
ImageFile = MTSL chemical structure.png ImageSize = 150px
IUPACName = "S"-(2,2,5,5-tetramethyl-2,5-dihydro-1H-pyrrol-3-yl)methyl methanesulfonothioate
OtherNames = MTSL
Section1 = Chembox Identifiers
CASNo = 81213-52-7
PubChem =
SMILES = CC1(C)C(CSS(C)(=O)=O)=CC(C)(C) [N+] 1 [O-]
Section2 = Chembox Properties
C=10|H=18|N=1|O=3|S=2
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =

MTSL is a chemical compound which can be used as a nitroxide (amine oxide) paramagnetic spin label in protein NMR spectroscopy experiments. MTSL is attached via a disulfide bond to a cysteine residue, enabling site-directed spin labelling. Following attachment, which involves a CH₃SO₂ leaving groupFact|date=January 2008, the MTSL moiety will add 186.3 daltons to the mass of the protein or peptide to which it is attached. The cysteine can be introduced using site-directed mutagenesis, and hence most positions in a protein can be labelled. The paramagnetic group introduced into the protein, increases the relaxation rate of the nearby nuclei. This can be detected as peak broadening and loss of intensity in peaks corresponding to nearby nuclei. Hence proximity can be inferred for all nuclei, that are affected. A major advantage of this method over traditional methods for obtaining distance restraints in protein NMR is the increased length, as paramagnetic relaxation enhancement can detect distances up to 25 Å (2.5 nm) as opposed to about 6 Å (0.6 nm) using the nuclear Overhauser effect. Spin labelling with MTSL is frequently used in investigation of residual structure in intrinsically unstructured proteins.