Homosalate

Chembox new
Name = Homosalate
ImageFile = Homosalate.png ImageName =
IUPACName = 3,3,5-Trimethylcyclohexyl 2-hydroxybenzoate
OtherNames = Homosalate
Section1 = Chembox Identifiers
CASNo = 118-56-9
SMILES = OC1=CC=CC=C1C(OC2CC(C)CC(C)(C)C2)=O
Section2 = Chembox Properties
Formula = C₁₆H₂₂O₃
MolarMass = 262.36 g/mol
Density = 1.045 g/cm³
MeltingPt =<25 °C
BoilingPt = 161-165 °C at 4 mmHg

Homosalate is an organic compound used in some sunscreens. It is an ester formed from salicylic acid and 3,3,5-trimethylcyclohexanol, a derivative of cyclohexanol. It is found in many Coppertone products.

The salicylic acid portion of the molecule absorbs ultraviolet rays with a wavelength from 295nm to 315nm, protecting the skin from sun damage. The hydrophobic cyclohexanol portion provides greasiness that prevents it from dissolving in water.

ee also

*Octyl salicylate
*Trolamine salicylate

References

*"Merck Index", 11th Edition, 4660.