Elemicin

Chembox new
Name = Elemicin
ImageFile = Elemicin.png ImageName = Elemicin
IUPACName = 1,2,3-trimethoxy-5-
(2-propenyl)benzene
OtherNames = 5-allyl-1,2,3-trimethoxybenzene
Section1 = Chembox Identifiers
CASNo = 487-11-6
SMILES = C=CCC1=CC(OC)=C(OC)C(OC)=C1
Section2 = Chembox Properties
Formula = C₁₂H₁₆O₃
MolarMass = 208.25 g/mol
Density =
MeltingPt =
BoilingPt =

Elemicin (3,4,5-trimethoxyallylbenzene) - a natural organic compound that is a constituent of the essential oil of nutmeg. It is believed to be partially responsible for the subtle psychoactive effects of nutmeg.citation | first1 = Alexander T. | last1 = Shulgin | author1-link = Alexander Shulgin | last2 = Sargent | first2 = Thornton W. | last3 = Naranjo | first3 = Claudio | title = Chemistry and psychopharmacology of nutmeg and of several related phenylisopropylamines | journal = United States, Public Health Service Publication | year = 1967 | Issue = 1645 | pages = 202-214] Elemicin is also a minor constituent of the oleoresin and essential oil of Manila Elemi ("Canarium luzonicum"). One study found it to comprise 2.4% of the fresh essential oil.cite journal | first1 = Kemal Hüsnü Can .| last1 = Baser | last2 = Özek | first2 = Temel | last3 = Kürkçüoglu | first3 = Mine | last4 = Villanueva | first4 = Merle A. | last 5 = Torres | first5 = Rosalinda C. | title = The Composition of Manila Elemi Oil | journal = Flavour And Fragrance Journal | year = 1993 | volume = 8 | pages = 35-37 | url=http://itdi.dost.gov.ph/R&D/cmd/elemioil.pdf ]

References