Vilazodone

drugbox
IUPAC_name = 5- [4- [4-(5-cyano-1H-indol-3-yl)butyl] piperazin-1-yl] -1-benzofuran-2-carboxamide

---

width = 240
CAS_number =
ATC_prefix =
ATC_suffix =
PubChem = 6918313
DrugBank =
C=26|H=27|N=5|O=2
molecular_weight = 441.524 g/mol
smiles = C1CN(CCN1CCCCC2=CNC3=C2C=C(C=C3)C#N)C4=CC5=C(C=C4)OC(=C5)C(=O)N
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =

Vilazodone is a dual-mechanism antidepressant and anxiolytic drug. It functions as both an SSRI, and a 5-HT_1A receptor agonist. [Page ME, Cryan JF, Sullivan A, Dalvi A, Saucy B, Manning DR, Lucki I. Behavioral and neurochemical effects of 5-(4- [4-(5-Cyano-3-indolyl)-butyl)-butyl] -1-piperazinyl)-benzofuran-2-carboxamide (EMD 68843): a combined selective inhibitor of serotonin reuptake and 5-hydroxytryptamine(1A) receptor partial agonist. "Journal of Pharmacology and Experimental Therapeutics". 2002 Sep;302(3):1220-7. PMID 12183683] Vilazodone is currently in phase III clinical trials. [de Paulis T. Drug evaluation: Vilazodone--a combined SSRI and 5-HT1A partial agonist for the treatment of depression. "IDrugs". 2007 Mar;10(3):193-201. PMID 17351874]

References