Perospirone

Drugbox
IUPAC_name = (3a"S",7a"R")-2- [4- [4-(1,2-benzothiazol-3-yl)piperazin-1-yl] butyl] -3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione

---

CAS_number = 150915-41-6
CAS_supplemental =
ATC_prefix =
ATC_suffix =
ATC_supplemental =
PubChem = 115368
DrugBank =
chemical_formula =
C=23 | H=30 | N=4 | O=2 | S=1
molecular_weight = 426.57 g/mol
smiles = C1CCC2C(C1)C(=O)N(C2=O)CCCCN3CCN(CC3)C4=NSC5=CC=CC=C54
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status = Rx-only
routes_of_administration = Oral

Perospirone (INN, marketed by Dainippon Sumitomo Pharma under the trade name Lullan) is an neuroleptic.

It is a 5-HT₂ receptor antagonist.cite journal |author=Ohno Y, Ishibashi T, Okada K, Ishida K, Nakamura M |title=Effects of subchronic treatments with SM-9018, a novel 5-HT2 and D2 antagonist, on dopamine and 5-HT receptors in rats |journal=Prog. Neuropsychopharmacol. Biol. Psychiatry |volume=19 |issue=6 |pages=1091–101 |year=1995 |month=October |pmid=8584685 |doi= |url=http://linkinghub.elsevier.com/retrieve/pii/0278584695001999] Clinical trials show that extrapyramidal symptoms tend to occur less often and were generally milder than with haloperidol or mosapramine.cite journal |author=Onrust SV, McClellan K |title=Perospirone |journal=CNS Drugs |volume=15 |issue=4 |pages=329–37; discussion 338 |year=2001 |pmid=11463136 |doi= |url=]

References