Sofalcone

Drugbox
IUPAC_name = 2- [5-(3-methylbut-2-enoxy)-2- [("E")-3- [4-(3-methylbut-2-enoxy)phenyl] prop-2-enoyl] phenoxy] acetic acid

---

CAS_number = 64506-49-6
CAS_supplemental =
ATC_prefix =
ATC_suffix =
ATC_supplemental =
PubChem = 5282219
DrugBank =
C=27 | H=30 | O=6
molecular_weight = 450.52 g/mol
smiles = CC(=CCOC1=CC=C(C=C1)C=CC(=O)C2=C(C=C(C=C2)OCC=C(C)C)OCC(=O)O)C
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status = Rx-only
routes_of_administration = Oral

Sofalcone (INN) is an oral gastrointestinal medication. It is a synthetic derivative of sophoradin, [cite journal |author=Konturek SJ, Mrzozowski T, Drozdowicz D, Pawlik W, Sendur R |title=Gastroprotective and ulcer healing effects of solon, a synthetic flavonoid derivative of sophoradin |journal=Hepatogastroenterology |volume=34 |issue=4 |pages=164–70 |year=1987 |month=August |pmid=3478294 |doi= |url=] a flavonoid found in "Sophora tonkinensis" (or "Sophora subprostrata"), a herb used in traditional Chinese medicine.

References