- Efaproxiral
Drugbox
IUPAC_name = 2- [4- [2- [(3,5-dimethylphenyl)amino] -2-oxoethyl] phenoxy] -2-methylpropanoic acid
CAS_number = 131179-95-8
CAS_supplemental =
ATC_prefix = L01
ATC_suffix = XD06
ATC_supplemental =
PubChem = 122335
DrugBank =
chemical_formula =
C=20 | H=23 | N=1 | O=4
molecular_weight = 341.40 g/mol
smiles = CC1=CC(=CC(=C1)NC(=O)CC2=CC=C(C=C2)OC(C)(C)C(=O)O)C
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =Efaproxiral (INN) is an allosteric effector of
hemoglobin .cite journal |author=Kunert MP, Liard JF, Abraham DJ |title=RSR-13, an allosteric effector of hemoglobin, increases systemic and iliac vascular resistance in rats |journal=Am. J. Physiol. |volume=271 |issue=2 Pt 2 |pages=H602–13 |year=1996 |month=August |pmid=8770102 |doi= |url=http://ajpheart.physiology.org/cgi/pmidlookup?view=long&pmid=8770102]References
Wikimedia Foundation. 2010.
