Temoporfin

Drugbox
IUPAC_name = 3,3',3",3"'-(7,8-Dihydroporphyrin-5,10,15,20-tetrayl)tetraphenol

---

CAS_number = 122341-38-2
CAS_supplemental =
ATC_prefix = L01
ATC_suffix = XD05
ATC_supplemental =
PubChem = 60751
DrugBank =
chemical_formula =
C=44 | H=32 | N=4 | O=4
molecular_weight = 680.74 g/mol
smiles = C1CC2=NC1=C(C3=CC=C(N3)C(=C4C=CC(=N4)C(=C5C=CC(=C2C6=CC(=CC=C6)O)N5)C7=CC(=CC=C7)O)C8=CC(=CC=C8)O)C9=CC(=CC=C9)O
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
licence_EU = Foscan
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status = Rx-only
routes_of_administration =

Temoporfin (INN) is a photosensitizer used in chemotherapy for the treatment of squamous cell carcinoma of the head and neckcite journal |author=Lorenz KJ, Maier H |title= [Squamous cell carcinoma of the head and neck. Photodynamic therapy with Foscan] |language=German |journal=HNO |volume=56 |issue=4 |pages=402–9 |year=2008 |month=April |pmid=17516041 |doi=10.1007/s00106-007-1573-1 |url=] . It is marketed in the European Union under the brand name Foscan.

References