Acecarbromal

Drugbox
IUPAC_name = N-(acetylcarbamoyl)-2-bromo-2-ethylbutanamide


CAS_number = 77-66-7
CAS_supplemental =
ATC_prefix =
ATC_suffix =
ATC_supplemental =
PubChem = 6489
DrugBank =
chemical_formula =
C=9 | H=15 | Br=1 | N=2 | O=3
molecular_weight = 279.131 g/mol
smiles = CCC(CC)(C(=O)NC(=O)NC(=O)C)Br
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =

Acecarbromal (INN) is a sedative drug. It is sold in combination with extract of quebracho and vitamin e as a treatment for erectile dysfunction under the brand name Afrodor. [Baumbusch F, Papp GK, Kopa ZS. Treatment for potency problems with Afrodor 2000. "Acta Chirurgica Hungarica". 1995-1996;35(1-2):87-92. PMID 8659243] [Sperling H, Lümmen G, Luboldt HJ, Rübben H. Secondary erectile dysfunction. Is oral medication in the diagnostic phase indicated? (German). "Der Urologe Ausg A". 1999 Jan;38(1):56-9. PMID 10081103]

References