- Etazolate
drugbox
IUPAC_name = Ethyl 1-ethyl-4-(2-propan-2-ylidenehydrazinyl)pyrazolo [4,5-e] pyridine-5-carboxylate
width = 200
CAS_number = 51022-77-6
synonyms = Etazolate
ATC_prefix =
ATC_suffix =
PubChem = 3277
DrugBank =
C = 14 | H = 19 | N = 5 | O = 2
molecular_weight = 289.33 g/mol
smiles = CCN1C2=NC=C(C(=C2C=N1)NN=C(C)C)C(=O)OCC
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =Etazolate is a pyrazolopyridine derivative drug,cite journal |author=Ticku MK, Davis WC |title=Molecular interactions of etazolate with benzodiazepine and picrotoxinin binding sites |journal=J. Neurochem. |volume=38 |issue=4 |pages=1180–2 |year=1982 |pmid=6278085 |doi=] which acts as an
anxiolytic . [Williams M. Anxioselective anxiolytics. "Journal of Medicinal Chemistry". 1983 May;26(5):619-28. PMID 6132997]It has several mechanisms of action, acting as an
adenosine antagonist, [Williams M, Jarvis MF. Adenosine antagonists as potential therapeutic agents. "Pharmacology Biochemistry and Behaviour". 1988 Feb;29(2):433-41. PMID 3283781] a subtype-selective GABAA receptor partial agonist, [Zezula J, Slany A, Sieghart W. Interaction of allosteric ligands with GABAA receptors containing one, two, or three different subunits. "European Journal of Pharmacology". 1996 Apr 22;301(1-3):207-14. PMID 8773466] and aphosphodiesterase inhibitor selective for the PDE4 subtype. [Wang P, Myers JG, Wu P, Cheewatrakoolpong B, Egan RW, Billah MM. Expression, purification, and characterization of human cAMP-specific phosphodiesterase (PDE4) subtypes A, B, C, and D. "Biochemical and Biophysical Research Communications". 1997 May 19;234(2):320-4. PMID 9177268]ee also
*
Nicotinic acids References
Wikimedia Foundation. 2010.
